4-Hydroxy-6-methyl-2-(trifluoromethyl)quinoline structure
|
Common Name | 4-Hydroxy-6-methyl-2-(trifluoromethyl)quinoline | ||
|---|---|---|---|---|
| CAS Number | 1701-20-8 | Molecular Weight | 227.18300 | |
| Density | 1.34g/cm3 | Boiling Point | 251.5ºC at 760mmHg | |
| Molecular Formula | C11H8F3NO | Melting Point | 252-253°C | |
| MSDS | N/A | Flash Point | 105.9ºC | |
| Name | 4-Hydroxy-6-methyl-2-(trifluoromethyl)quinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 251.5ºC at 760mmHg |
| Melting Point | 252-253°C |
| Molecular Formula | C11H8F3NO |
| Molecular Weight | 227.18300 |
| Flash Point | 105.9ºC |
| Exact Mass | 227.05600 |
| PSA | 33.12000 |
| LogP | 3.26760 |
| Vapour Pressure | 0.0204mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | UNVMZLUVACVTDT-UHFFFAOYSA-N |
| SMILES | Cc1ccc2[nH]c(C(F)(F)F)cc(=O)c2c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2933499090 |
|
~89%
4-Hydroxy-6-met... CAS#:1701-20-8 |
| Literature: Huang, Wei-Yuan; Liu, Yan-Song; Lu, Long Journal of Fluorine Chemistry, 1994 , vol. 66, # 2 p. 209 - 214 |
|
~%
4-Hydroxy-6-met... CAS#:1701-20-8 |
| Literature: Journal of Fluorine Chemistry, , vol. 66, # 2 p. 209 - 214 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Methyl-2-(trifluoromethyl)quinolin-4-ol |
| MFCD00153192 |
| 4-HYDROXY-6-METHYL-2-(TRIFLUOROMETHYL)QUINOLINE |