6-Bromo-4-hydroxy-2-(trifluoromethyl)quinoline structure
|
Common Name | 6-Bromo-4-hydroxy-2-(trifluoromethyl)quinoline | ||
|---|---|---|---|---|
| CAS Number | 1701-22-0 | Molecular Weight | 292.05200 | |
| Density | 1.724g/cm3 | Boiling Point | 277.9ºC at 760mmHg | |
| Molecular Formula | C10H5BrF3NO | Melting Point | >290ºC | |
| MSDS | USA | Flash Point | 121.9ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 6-Bromo-4-hydroxy-2-(trifluoromethyl)quinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.724g/cm3 |
|---|---|
| Boiling Point | 277.9ºC at 760mmHg |
| Melting Point | >290ºC |
| Molecular Formula | C10H5BrF3NO |
| Molecular Weight | 292.05200 |
| Flash Point | 121.9ºC |
| Exact Mass | 290.95100 |
| PSA | 33.12000 |
| LogP | 3.72170 |
| Vapour Pressure | 0.0728mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | HIBGBUAHZUWVNW-UHFFFAOYSA-N |
| SMILES | O=c1cc(C(F)(F)F)[nH]c2ccc(Br)cc12 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 |
| Precautionary Statements | P301 + P310 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Bromo-2-(trifluoromethyl)quinolin-4-ol |
| 6-BROMO-4-HYDROXY-2-(TRIFLUOROMETHYL)QUINOLINE |
| 6-Bromo-4-hydroxy-2-trifluoromethylquinoline |
| MFCD00153078 |