[2,6-dimethoxy-4-(4-methylpiperazine-1-carbonyl)phenyl] ethyl carbonate structure
|
Common Name | [2,6-dimethoxy-4-(4-methylpiperazine-1-carbonyl)phenyl] ethyl carbonate | ||
|---|---|---|---|---|
| CAS Number | 1703-37-3 | Molecular Weight | 352.38200 | |
| Density | 1.198g/cm3 | Boiling Point | 516.4ºC at 760mmHg | |
| Molecular Formula | C17H24N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.1ºC | |
| Name | [2,6-dimethoxy-4-(4-methylpiperazine-1-carbonyl)phenyl] ethyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.198g/cm3 |
|---|---|
| Boiling Point | 516.4ºC at 760mmHg |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.38200 |
| Flash Point | 266.1ºC |
| Exact Mass | 352.16300 |
| PSA | 77.54000 |
| LogP | 1.50250 |
| Vapour Pressure | 8.98E-11mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | KUGFJSRLHIUQHG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Oc1c(OC)cc(C(=O)N2CCN(C)CC2)cc1OC |
| 1-(4-ethoxycarbonyloxy-3,5-dimethoxy-benzoyl)-4-methyl-piperazine |
| Carbonic acid,ethyl ester,ester with 1-(4-hydroxy-3,5-dimethoxybenzoyl)-4-methylpiperazine |
| 2,6-dimethoxy-4-[(4-methylpiperazin-1-yl)carbonyl]phenyl ethyl carbonate |
| N-Methyl-N'-(3,4-dimethoxy-4-ethoxycarbonyloxy-benzoyl)-piperazin |
| LG 50,056 |