4-Oxo-1,2-cyclopentanedicarboxylic acid structure
|
Common Name | 4-Oxo-1,2-cyclopentanedicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1703-61-3 | Molecular Weight | 172.135 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 466.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C7H8O5 | Melting Point | 189ºC | |
| MSDS | N/A | Flash Point | 250.2±25.2 °C | |
| Name | 4-Oxocyclopentane-1,2-dicarboxylic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 466.7±45.0 °C at 760 mmHg |
| Melting Point | 189ºC |
| Molecular Formula | C7H8O5 |
| Molecular Weight | 172.135 |
| Flash Point | 250.2±25.2 °C |
| Exact Mass | 172.037170 |
| PSA | 91.67000 |
| LogP | -1.60 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | CJSMOECOKYPHSC-UHFFFAOYSA-N |
| SMILES | O=C1CC(C(=O)O)C(C(=O)O)C1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918300090 |
|
~91%
4-Oxo-1,2-cyclo... CAS#:1703-61-3 |
| Literature: TIBOTEC PHARMACEUTICALS LTD. Patent: WO2008/92955 A1, 2008 ; Location in patent: Page/Page column 24 ; |
|
~%
4-Oxo-1,2-cyclo... CAS#:1703-61-3 |
| Literature: Synlett, , vol. 1997, # 2 p. 193 - 194 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-Oxocyclopentane-1,2-dicarboxylic acid |
| 1,2-Cyclopentanedicarboxylic acid, 4-oxo- |
| 4-Oxo-1,2-cyclopentanedicarboxylic acid |