Methyl 1-acetyl-4-oxo-3-piperidinecarboxylate structure
|
Common Name | Methyl 1-acetyl-4-oxo-3-piperidinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 17038-83-4 | Molecular Weight | 199.204 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 287.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.6±25.9 °C | |
| Name | methyl 1-acetyl-4-oxopiperidine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 287.4±35.0 °C at 760 mmHg |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.204 |
| Flash Point | 127.6±25.9 °C |
| Exact Mass | 199.084457 |
| PSA | 63.68000 |
| LogP | -0.77 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.488 |
| InChIKey | SIAOHJSZJXTQGK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CN(C(C)=O)CCC1=O |
| HS Code | 2933399090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Acetyl-4-oxo-3-piperidinecarboxylic acid methyl ester |
| Methyl 1-acetyl-4-oxo-3-piperidinecarboxylate |
| 3-Piperidinecarboxylic acid, 1-acetyl-4-oxo-, methyl ester |