Methyl 1-benzyl-4-oxopiperidine-3-carboxylate hydrochloride structure
|
Common Name | Methyl 1-benzyl-4-oxopiperidine-3-carboxylate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 3939-01-3 | Molecular Weight | 283.751 | |
| Density | N/A | Boiling Point | 366ºC at 760mmHg | |
| Molecular Formula | C14H18ClNO3 | Melting Point | 185 °C (dec.)(lit.) | |
| MSDS | N/A | Flash Point | 175.2ºC | |
| Name | Methyl 1-benzyl-4-oxopiperidine-3-carboxylate hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 366ºC at 760mmHg |
|---|---|
| Melting Point | 185 °C (dec.)(lit.) |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.751 |
| Flash Point | 175.2ºC |
| Exact Mass | 283.097534 |
| PSA | 46.61000 |
| LogP | 1.99050 |
| InChIKey | BRADBAOVPACOQQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CN(Cc2ccccc2)CCC1=O.Cl |
|
~96%
Methyl 1-benzyl... CAS#:3939-01-3 |
| Literature: Busch, Frank R; Chiu, Charles K; Meltz, Clifford N; Post, Ronald J; Rose, Peter R Patent: US2002/2283 A1, 2002 ; |
|
~%
Methyl 1-benzyl... CAS#:3939-01-3 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 27, # 7 p. 1885 - 1892 |
|
~%
Methyl 1-benzyl... CAS#:3939-01-3 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 27, # 7 p. 1885 - 1892 |
| Precursor 4 | |
|---|---|
| DownStream 6 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride (1:1) |
| Methyl 1-benzyl-4-oxopiperidine-3-carboxylate hydrochloride (1:1) |
| EINECS 223-522-2 |
| MFCD00012799 |
| 1-Benzyl-4-oxo-3-piperidinecarboxylic Acid Methyl Ester Hydrochloride |
| 3-Piperidinecarboxylic acid, 4-oxo-1-(phenylmethyl)-, methyl ester, hydrochloride (1:1) |
| Methyl 1-Benzyl-4-oxo-3-piperidinecarboxylate Hydrochloride |
| 1-Benzyl-3-methoxycarbonyl-4-piperidone Hydrochloride |
| methyl 1-benzyl-4-oxopiperidine-3-carboxylate,hydrochloride |
| methyl-1-benzyl-4-oxopiperidin-3-carboxylathydrochlorid |
| Methyl 1-benzyl-4-oxo-3-piperidine-carboxylate hydrochloride |
| Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride |