Celecoxib Carboxylic Acid structure
|
Common Name | Celecoxib Carboxylic Acid | ||
|---|---|---|---|---|
| CAS Number | 170571-01-4 | Molecular Weight | 411.35500 | |
| Density | 1.571g/cm3 | Boiling Point | 612.122ºC at 760 mmHg | |
| Molecular Formula | C17H12F3N3O4S | Melting Point | 237-239ºC | |
| MSDS | N/A | Flash Point | 324ºC | |
Use of Celecoxib Carboxylic AcidCelecoxib Carboxylic Acid is a metabolite of Celecoxib, which is a COX-2 inhibitor. |
| Name | 4-[2-(4-sulfamoylphenyl)-5-(trifluoromethyl)pyrazol-3-yl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.571g/cm3 |
|---|---|
| Boiling Point | 612.122ºC at 760 mmHg |
| Melting Point | 237-239ºC |
| Molecular Formula | C17H12F3N3O4S |
| Molecular Weight | 411.35500 |
| Flash Point | 324ºC |
| Exact Mass | 411.05000 |
| PSA | 123.66000 |
| LogP | 4.68480 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | WTHNOVFEXONZMI-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccc(-n2nc(C(F)(F)F)cc2-c2ccc(C(=O)O)cc2)cc1 |
| Celecoxib metabolite M2 |
| 4-[1-[4-(Aminosulfonyl)phenyl]-3-(trifluoromethyl)-1H-pyrazol-5-yl]benzoic Acid |
| Celecoxib Carboxylic Acid |
| Celebrex Carboxylic Acid |
| UNII-EQJ1364UKF |
| Celecoxib Impurity 2 |