Benzenamine,N-[(2-nitrophenyl)methylene]- structure
|
Common Name | Benzenamine,N-[(2-nitrophenyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 17064-77-6 | Molecular Weight | 226.23100 | |
| Density | 1.16g/cm3 | Boiling Point | 383.4ºC at 760mmHg | |
| Molecular Formula | C13H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.7ºC | |
| Name | 1-(2-nitrophenyl)-N-phenylmethanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 383.4ºC at 760mmHg |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.23100 |
| Flash Point | 185.7ºC |
| Exact Mass | 226.07400 |
| PSA | 58.18000 |
| LogP | 3.86860 |
| Vapour Pressure | 9.75E-06mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | BBAZSPGQKPGVIJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1C=Nc1ccccc1 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| T0509-0369 |
| N-phenylimine of o-nitrobenzaldehyde |
| N-o-nitrobenzylideneaniline |