N-(2-methylphenyl)-1-(2-nitrophenyl)methanimine structure
|
Common Name | N-(2-methylphenyl)-1-(2-nitrophenyl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 17064-80-1 | Molecular Weight | 240.25700 | |
| Density | 1.14g/cm3 | Boiling Point | 393.2ºC at 760mmHg | |
| Molecular Formula | C14H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.6ºC | |
| Name | N-(2-methylphenyl)-1-(2-nitrophenyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 393.2ºC at 760mmHg |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.25700 |
| Flash Point | 191.6ºC |
| Exact Mass | 240.09000 |
| PSA | 58.18000 |
| LogP | 4.17700 |
| Vapour Pressure | 4.91E-06mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | MYYHTZHAWHKOHN-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1N=Cc1ccccc1[N+](=O)[O-] |
|
~%
N-(2-methylphen... CAS#:17064-80-1 |
| Literature: Dou, Guolan; Shi, Daqing; Li, Yonghai Journal of Combinatorial Chemistry, 2010 , vol. 12, # 1 p. 195 - 199 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-<2-Nitro-benzyliden>-2-methyl-anilin |
| N-o-nitribenzylidene-o-toluidine |
| 2-Nitro-benzaldehyd-o-tolylimin |