N-(2-Nitrobenzylidene)-P-toluidine structure
|
Common Name | N-(2-Nitrobenzylidene)-P-toluidine | ||
|---|---|---|---|---|
| CAS Number | 17064-82-3 | Molecular Weight | 240.25700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-methylphenyl)-1-(2-nitrophenyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12N2O2 |
|---|---|
| Molecular Weight | 240.25700 |
| Exact Mass | 240.09000 |
| PSA | 58.18000 |
| LogP | 4.17700 |
| InChIKey | YKRSQWCMPJDBOD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N=Cc2ccccc2[N+](=O)[O-])cc1 |
|
~99%
N-(2-Nitrobenzy... CAS#:17064-82-3 |
| Literature: Rothenberg; Downie; Raston; Scott Journal of the American Chemical Society, 2001 , vol. 123, # 36 p. 8701 - 8708 |
| N-(2-NITROBENZYLIDENE)-P-TOLUIDINE |
| (2-Nitro-benzal)-p-toluidin |
| N-(2-nitro-benzylidene)-p-toluidine |
| 4-methyl-N-(2-nitrobenzylidene)aniline |
| (2-Nitro-benzaldehyd)-p-tolylimid |
| N-(2-Nitro-benzyliden)-p-toluidin |