Tetrakis(dimethylsilyl) Orthosilicate structure
|
Common Name | Tetrakis(dimethylsilyl) Orthosilicate | ||
|---|---|---|---|---|
| CAS Number | 17082-47-2 | Molecular Weight | 328.733 | |
| Density | 0.884 g/mL at 25 °C(lit.) | Boiling Point | 228.3±23.0 °C at 760 mmHg | |
| Molecular Formula | C8H28O4Si5 | Melting Point | <0ºC | |
| MSDS | N/A | Flash Point | 91.9±22.6 °C | |
| Name | Tetrakis(dimethylsilyloxy)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.884 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 228.3±23.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C8H28O4Si5 |
| Molecular Weight | 328.733 |
| Flash Point | 91.9±22.6 °C |
| Exact Mass | 328.083374 |
| PSA | 36.92000 |
| LogP | 10.64 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | n20/D 1.387(lit.) |
| InChIKey | UOUILILVWRHZSH-UHFFFAOYSA-N |
| SMILES | C[Si](C)O[Si](O[Si](C)C)(O[Si](C)C)O[Si](C)C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2931900090 |
|
~77%
Tetrakis(dimeth... CAS#:17082-47-2 |
| Literature: Kalmychkov, G. V.; Yarosch, N. K.; Mirskov, R. G.; Voronkov, M. G.; Rakhlin, V. I. J. Gen. Chem. USSR (Engl. Transl.), 1992 , vol. 62, # 3.2 p. 710 - 711,590 |
|
~%
Tetrakis(dimeth... CAS#:17082-47-2 |
| Literature: US2012/46485 A1, ; Page/Page column 5 ; |
|
~68%
Tetrakis(dimeth... CAS#:17082-47-2 |
| Literature: Applied Organometallic Chemistry, , vol. 24, # 3 p. 251 - 256 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Tetrakis(diMethylsilyloxy)silane |
| Silicic acid (HSiO), tetrakis(dimethylsilyl) ester |
| MFCD00053848 |
| tetrakis(dimethylsiloxy)silane |
| Tetrakis(dimethylsilyl) orthosilicate |
| EINECS 222-613-4 |