Substituted piperidines-1 structure
|
Common Name | Substituted piperidines-1 | ||
|---|---|---|---|---|
| CAS Number | 170842-46-3 | Molecular Weight | 517.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H39N7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Substituted piperidines-1Substituted piperidines-1 is a compound that can promote the release of growth hormone in humans and animals. |
| Name | Substituted piperidines-1 |
|---|
| Description | Substituted piperidines-1 is a compound that can promote the release of growth hormone in humans and animals. |
|---|---|
| Related Catalog | |
| In Vitro | Substituted piperidines-1 is from patent US5721251A, Page 14, line 15 to 25. |
| References |
[1]. US5721251A |
| Molecular Formula | C29H39N7O2 |
|---|---|
| Molecular Weight | 517.67 |
| InChIKey | NLJAGSJEAGPLOW-RUZDIDTESA-N |
| SMILES | CC(C)(N)C(=O)NC(CCCc1ccccc1)C(=O)N1CCC(c2ccccc2CCc2nn[nH]n2)CC1 |
| Storage condition | 2-8℃ |