Propanedioicacid, 2-(2,2-dimethylpropylidene)-, 1,3-diethyl ester structure
|
Common Name | Propanedioicacid, 2-(2,2-dimethylpropylidene)-, 1,3-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 17085-89-1 | Molecular Weight | 228.28500 | |
| Density | 1.005g/cm3 | Boiling Point | 248.7ºC at 760mmHg | |
| Molecular Formula | C12H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 108.1ºC | |
| Name | diethyl 2-(2,2-dimethylpropylidene)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.005g/cm3 |
|---|---|
| Boiling Point | 248.7ºC at 760mmHg |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.28500 |
| Flash Point | 108.1ºC |
| Exact Mass | 228.13600 |
| PSA | 52.60000 |
| LogP | 2.08510 |
| Vapour Pressure | 0.0239mmHg at 25°C |
| Index of Refraction | 1.45 |
| InChIKey | WBXLTCRTGYJWFQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=CC(C)(C)C)C(=O)OCC |
|
~%
Propanedioicaci... CAS#:17085-89-1 |
| Literature: Foreman; McElvain Journal of the American Chemical Society, 1940 , vol. 62, p. 1435,1436 |
| neopentylidene-malonic acid diethyl ester |
| Neopentyliden-malonsaeure-diaethylester |