3-(Methacryloyloxy)Propyl Tris(Trimethylsiloxy)Silane structure
|
Common Name | 3-(Methacryloyloxy)Propyl Tris(Trimethylsiloxy)Silane | ||
|---|---|---|---|---|
| CAS Number | 17096-07-0 | Molecular Weight | 422.812 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 368.6±44.0 °C at 760 mmHg | |
| Molecular Formula | C16H38O5Si4 | Melting Point | <0ºC | |
| MSDS | Chinese USA | Flash Point | 146.9±24.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-(Methacryloyloxy)Propyltris(Trimethylsiloxy)Silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 368.6±44.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C16H38O5Si4 |
| Molecular Weight | 422.812 |
| Flash Point | 146.9±24.0 °C |
| Exact Mass | 422.179626 |
| PSA | 53.99000 |
| LogP | 8.18 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.432 |
| InChIKey | BESKSSIEODQWBP-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| Storage condition | below 5° C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~80%
3-(Methacryloyl... CAS#:17096-07-0 |
| Literature: US2010/29972 A1, ; Page/Page column 4 ; |
|
~%
3-(Methacryloyl... CAS#:17096-07-0 |
| Literature: WO2008/42158 A1, ; Page/Page column 40 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-{1,1,1,5,5,5-Hexamethyl-3-[(trimethylsilyl)oxy]-3-trisiloxanyl}propyl methacrylate |
| 3-(1,1,1,5,5,5-Hexamethyl-3-((trimethylsilyl)oxy)trisiloxan-3-yl)propyl methacrylate |
| 2-Propenoic acid, 2-methyl-, 3-[3,3,3-trimethyl-1,1-bis[(trimethylsilyl)oxy]disiloxanyl]propyl ester |
| 3-{1,1,1,5,5,5-Hexamethyl-3-[(trimethylsilyl)oxy]trisiloxan-3-yl}propyl methacrylate |
| MFCD00053871 |
| 3-(3,3,3-Trimethyl-1,1-bis((trimethylsilyl)oxy)disiloxanyl)propyl methacrylate |
| 3-(METHACRYLOYLOXY)PROPYLTRIS(TRIMETHYLSILOXY)SILANE |
| 3-[Tris(triMethylsilyloxy)silyl]propyl Methacrylate |
| (3-Methacryloyloxypropyl)tris(trimethylsiloxy)silane,Tris |
| Methacrylic Acid 3-[Tris(trimethylsilyloxy)silyl]propyl Ester |
| 3-[Tris(trimethylsiloxy)silyl]propyl methacrylate |
| EINECS 241-165-0 |
| 3-(Methacryloyloxy)propyltris(trimethylsilyloxy)silane |
| (3-Methacryloyloxypropyl)tris(trimethylsiloxy)silane |
| 3-(Methacryloyloxy)Propyl Tris(Trimethylsiloxy)Silane |