2-(methylnitroamino)ethyl nitrate
Modify Date: 2025-09-20 11:46:01
2-(methylnitroamino)ethyl nitrate structure
|
Common Name | 2-(methylnitroamino)ethyl nitrate | ||
|---|---|---|---|---|
| CAS Number | 17096-47-8 | Molecular Weight | 165.10500 | |
| Density | 1.408g/cm3 | Boiling Point | 321.8ºC at 760mmHg | |
| Molecular Formula | C3H7N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.4ºC | |
| Name | 2-[methyl(nitro)amino]ethyl nitrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.408g/cm3 |
|---|---|
| Boiling Point | 321.8ºC at 760mmHg |
| Molecular Formula | C3H7N3O5 |
| Molecular Weight | 165.10500 |
| Flash Point | 148.4ºC |
| Exact Mass | 165.03900 |
| PSA | 104.11000 |
| LogP | 0.36460 |
| Vapour Pressure | 0.000548mmHg at 25°C |
| Index of Refraction | 1.482 |
| InChIKey | XYKVWCZODOKFIK-UHFFFAOYSA-N |
| SMILES | CN(CCO[N+](=O)[O-])[N+](=O)[O-] |
| HS Code | 2922199090 |
|---|
|
~52%
2-(methylnitroa... CAS#:17096-47-8 |
| Literature: Izsak, Daniel; Klapoetke, Thomas M. Zeitschrift fur Anorganische und Allgemeine Chemie, 2011 , vol. 637, # 14-15 p. 2135 - 2141 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 241-168-7 |
| N-Methyl-2-nitratoethylnitramine |