1-(3,4,5-trimethoxyphenyl)butan-2-amine structure
|
Common Name | 1-(3,4,5-trimethoxyphenyl)butan-2-amine | ||
|---|---|---|---|---|
| CAS Number | 17097-73-3 | Molecular Weight | 239.31100 | |
| Density | 1.034g/cm3 | Boiling Point | 337.2ºC at 760mmHg | |
| Molecular Formula | C13H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.4ºC | |
| Name | 1-(3,4,5-trimethoxyphenyl)butan-2-amine |
|---|
| Density | 1.034g/cm3 |
|---|---|
| Boiling Point | 337.2ºC at 760mmHg |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31100 |
| Flash Point | 156.4ºC |
| Exact Mass | 239.15200 |
| PSA | 53.71000 |
| LogP | 2.69250 |
| Vapour Pressure | 0.000106mmHg at 25°C |
| Index of Refraction | 1.504 |
| InChIKey | DCYONQVUAUEKAJ-UHFFFAOYSA-N |
| SMILES | CCC(N)Cc1cc(OC)c(OC)c(OC)c1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |