N-(2-chlorophenyl)-1-(3-nitrophenyl)methanimine structure
|
Common Name | N-(2-chlorophenyl)-1-(3-nitrophenyl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 17099-17-1 | Molecular Weight | 260.67600 | |
| Density | 1.27g/cm3 | Boiling Point | 435.2ºC at 760 mmHg | |
| Molecular Formula | C13H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217ºC | |
| Name | 3,5,7-trimethyl-1-[2-(1,2,2,4-tetramethylpyrrolidin-1-ium-1-yl)ethyl]-3H-azepin-2-one,iodide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 435.2ºC at 760 mmHg |
| Molecular Formula | C13H9ClN2O2 |
| Molecular Weight | 260.67600 |
| Flash Point | 217ºC |
| Exact Mass | 260.03500 |
| PSA | 58.18000 |
| LogP | 4.52200 |
| Vapour Pressure | 2.27E-07mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | XCXWVLZKJOGFTE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(C=Nc2ccccc2Cl)c1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| N-<3-Nitro-benzyliden>-2-chlor-anilin |