3-(4-Chlorophenyl)-3-(2-phenylacetamido)propanoic acid structure
|
Common Name | 3-(4-Chlorophenyl)-3-(2-phenylacetamido)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 171002-19-0 | Molecular Weight | 317.767 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 571.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H16ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.7±30.1 °C | |
| Name | 3-(4-Chlorophenyl)-3-(2-phenylacetamido)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 571.9±50.0 °C at 760 mmHg |
| Molecular Formula | C17H16ClNO3 |
| Molecular Weight | 317.767 |
| Flash Point | 299.7±30.1 °C |
| Exact Mass | 317.081879 |
| PSA | 69.89000 |
| LogP | 2.78 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | WHDVSHRTSIEYRK-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(NC(=O)Cc1ccccc1)c1ccc(Cl)cc1 |
| Storage condition | 2-8°C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(4-Chlorophenyl)-3-[(phenylacetyl)amino]propanoic acid |
| Benzenepropanoic acid, 4-chloro-β-[(2-phenylacetyl)amino]- |
| 3-(4-chlorophenyl)-3-[(2-phenylacetyl)amino]propanoic acid |