1-Hexyl-3-methylimidazolium Chloride structure
|
Common Name | 1-Hexyl-3-methylimidazolium Chloride | ||
|---|---|---|---|---|
| CAS Number | 171058-17-6 | Molecular Weight | 202.724 | |
| Density | 1.0337 | Boiling Point | N/A | |
| Molecular Formula | C10H19ClN2 | Melting Point | -85 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-Hexyl-3-methylimidazolium chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0337 |
|---|---|
| Melting Point | -85 °C |
| Molecular Formula | C10H19ClN2 |
| Molecular Weight | 202.724 |
| Exact Mass | 202.123672 |
| PSA | 8.81000 |
| Index of Refraction | 1.514-1.518 |
| InChIKey | NKRASMXHSQKLHA-UHFFFAOYSA-M |
| SMILES | CCCCCCn1cc[n+](C)c1.[Cl-] |
| Hazard Codes | Xn:Harmful; |
|---|---|
| Risk Phrases | R22;R36/37/38 |
| Safety Phrases | S23-S24/25-S37/39-S26 |
| WGK Germany | 3 |
| HS Code | 2933290090 |
|
~98%
1-Hexyl-3-methy... CAS#:171058-17-6 |
| Literature: Chemistry - A European Journal, , vol. 12, # 20 p. 5328 - 5333 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Hexyl-3-methylimidazolium Chloride |
| 1-hexyl-3-methylimidazol-3-ium,chloride |
| MFCD03093289 |
| 3-Hexyl-1-methyl-1H-imidazol-3-ium chloride |
| 1H-Imidazolium, 3-hexyl-1-methyl-, chloride (1:1) |