Ethyl2-amino-2-[2-(2,4-dichlorophenyl)hydrazono]-acetate structure
|
Common Name | Ethyl2-amino-2-[2-(2,4-dichlorophenyl)hydrazono]-acetate | ||
|---|---|---|---|---|
| CAS Number | 171091-03-5 | Molecular Weight | 276.11900 | |
| Density | 1.432g/cm3 | Boiling Point | 377.742ºC at 760 mmHg | |
| Molecular Formula | C10H11Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.252ºC | |
| Name | ethyl 2-amino-2-[(2,4-dichlorophenyl)hydrazinylidene]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.432g/cm3 |
|---|---|
| Boiling Point | 377.742ºC at 760 mmHg |
| Molecular Formula | C10H11Cl2N3O2 |
| Molecular Weight | 276.11900 |
| Flash Point | 182.252ºC |
| Exact Mass | 275.02300 |
| PSA | 76.71000 |
| LogP | 3.01390 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | MTFKHQNRZCFCMS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(N)=NNc1ccc(Cl)cc1Cl |
| HS Code | 2928000090 |
|---|
|
~%
Ethyl2-amino-2-... CAS#:171091-03-5 |
| Literature: Buelow; Neber Chemische Berichte, 1912 , vol. 45, p. 3737,3743 Chemische Berichte, 1913 , vol. 46, p. 2040 |
|
~%
Ethyl2-amino-2-... CAS#:171091-03-5 |
| Literature: Buelow; Neber Chemische Berichte, 1912 , vol. 45, p. 3737,3743 Chemische Berichte, 1913 , vol. 46, p. 2040 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| amino-(2,4-dichloro-phenylhydrazono)-acetic acid ethyl ester |
| Oxalsaeure-aethylester-[amid-(2.4-dichlor-phenylhydrazon)] |
| Amino-(2,4-dichlor-phenylhydrazono)-essigsaeure-aethylester |
| Acetic acid,amino[(2,4-dichlorophenyl)hydrazono]-,ethyl ester |
| Ethyl 2-amino-2-[2-(2,4-dichlorophenyl)hydrazono] |
| Ethyl 2-amino-2-[2-(2,4-dichlorophenyl)hydrazono]-acetate |