(S)-N-ACETYL-4-BROMOPHENYLALANINE structure
|
Common Name | (S)-N-ACETYL-4-BROMOPHENYLALANINE | ||
|---|---|---|---|---|
| CAS Number | 171095-12-8 | Molecular Weight | 286.12200 | |
| Density | 1.514g/cm3 | Boiling Point | 507.4ºC at 760 mmHg | |
| Molecular Formula | C11H12BrNO3 | Melting Point | 191-193ºC | |
| MSDS | Chinese USA | Flash Point | 260.7ºC | |
| Name | (2S)-2-acetamido-3-(4-bromophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.514g/cm3 |
|---|---|
| Boiling Point | 507.4ºC at 760 mmHg |
| Melting Point | 191-193ºC |
| Molecular Formula | C11H12BrNO3 |
| Molecular Weight | 286.12200 |
| Flash Point | 260.7ºC |
| Exact Mass | 285.00000 |
| PSA | 66.40000 |
| LogP | 1.97180 |
| Vapour Pressure | 4.07E-11mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | LDCUXIARELPUCD-JTQLQIEISA-N |
| SMILES | CC(=O)NC(Cc1ccc(Br)cc1)C(=O)O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| L-Phenylalanine,N-acetyl-4-bromo |
| HMS566P21 |