Alachlor OA structure
|
Common Name | Alachlor OA | ||
|---|---|---|---|---|
| CAS Number | 171262-17-2 | Molecular Weight | 265.30500 | |
| Density | 1.183g/cm3 | Boiling Point | 398.4ºC at 760 mmHg | |
| Molecular Formula | C14H19NO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 194.7ºC | |
| Name | 2-[2,6-diethyl-N-(methoxymethyl)anilino]-2-oxoacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 398.4ºC at 760 mmHg |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.30500 |
| Flash Point | 194.7ºC |
| Exact Mass | 265.13100 |
| PSA | 66.84000 |
| LogP | 1.83290 |
| Vapour Pressure | 4.61E-07mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | MHCYOELBTPOBIU-UHFFFAOYSA-N |
| SMILES | CCc1cccc(CC)c1N(COC)C(=O)C(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| Alachlor OA |