alachlor structure
|
Common Name | alachlor | ||
|---|---|---|---|---|
| CAS Number | 15972-60-8 | Molecular Weight | 269.767 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 404.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H20ClNO2 | Melting Point | 39-42°C | |
| MSDS | Chinese USA | Flash Point | 198.1±28.7 °C | |
| Symbol |
GHS06, GHS08 |
Signal Word | Danger | |
| Name | alachlor |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 404.0±45.0 °C at 760 mmHg |
| Melting Point | 39-42°C |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.767 |
| Flash Point | 198.1±28.7 °C |
| Exact Mass | 269.118256 |
| PSA | 29.54000 |
| LogP | 2.92 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.540 |
| InChIKey | XCSGPAVHZFQHGE-UHFFFAOYSA-N |
| SMILES | CCc1cccc(CC)c1N(COC)C(=O)CCl |
| Water Solubility | 0.024 g/100 mL |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311 + H331-H370-H412 |
| Precautionary Statements | P260-P280-P301 + P310 + P330-P302 + P352 + P312-P304 + P340 + P312-P308 + P311 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R22;R40;R43;R50/53 |
| Safety Phrases | S36/37-S46-S60-S61-S62-S45 |
| RIDADR | UN 3077 |
| RTECS | AE1225000 |
| Packaging Group | I; II; III |
| Hazard Class | 6.1 |
| HS Code | 2924299034 |
|
~%
alachlor CAS#:15972-60-8 |
| Literature: Synthesis, , # 11 p. 942 - 944 |
|
~%
Detail
|
| Literature: Synthetic Communications, , vol. 19, # 11-12 p. 2133 - 2140 |
| Precursor 6 | |
|---|---|
| DownStream 6 | |
| HS Code | 2924299034 |
|---|---|
| Summary | 2924299034 n-(3-chloro-4-methylphenyl)-2-methylpentanamide。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:30.0% |
|
Environmental friendly method for urban wastewater monitoring of micropollutants defined in the Directive 2013/39/EU and Decision 2015/495/EU.
J. Chromatogr. A. 1418 , 140-9, (2015) The fate and removal of organic micropollutants in the environment is a demanding issue evidenced by the recent European policy. This work presents an analytical method for the trace quantification of... |
|
|
Influence of pesticide use in fruit orchards during blooming on honeybee mortality in 4 experimental apiaries.
Sci. Total Environ. 541 , 33-41, (2015) Samples of dead honey bees (Apis mellifera L.) were collected periodically from 4 different locations during citrus and stone fruit trees blooming season to evaluate the potential impact of agrochemic... |
|
|
Biodegradation of the acetanilide herbicides alachlor, metolachlor, and propachlor.
Crit. Rev. Microbiol 24(1) , 1-22, (1998) Alachlor, metolachlor, and propachlor are detoxified in biological systems by the formation of glutathione-acetanilide conjugates. This conjugation is mediated by glutathione-S-transferase, which is p... |
| Alanex |
| Satochlor |
| 2-Chloro-2',6'-diethyl-N-(methoxymethyl)acetanilide |
| Methachlor |
| Chimiclor |
| G1VN1O1&R B2 F2 |
| Acetamide, 2-chloro-N-(2,6-diethylphenyl)-N-(methoxymethyl)- |
| Lasso |
| Alachlore |
| alachlor |
| Lasagrin |
| Nitala |
| Metachlor |
| Perfect |
| Micro-Tech |
| 2-Chloro-N-(2,6-diethylphenyl)-N-(methoxymethyl)acetamide |
| EINECS 240-110-8 |
| MFCD00041817 |
| 2-chloro-2’,6’-diethyl-N-methoxymethylacetanilide |
| Alapaz |
| Alochlor |