4'-fluoro-4-(4-fluorophenyl)butyrophenone structure
|
Common Name | 4'-fluoro-4-(4-fluorophenyl)butyrophenone | ||
|---|---|---|---|---|
| CAS Number | 17135-49-8 | Molecular Weight | 260.27900 | |
| Density | 1.166g/cm3 | Boiling Point | 375.5ºC at 760mmHg | |
| Molecular Formula | C16H14F2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.4ºC | |
| Name | 1,4-bis(4-fluorophenyl)butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.166g/cm3 |
|---|---|
| Boiling Point | 375.5ºC at 760mmHg |
| Molecular Formula | C16H14F2O |
| Molecular Weight | 260.27900 |
| Flash Point | 143.4ºC |
| Exact Mass | 260.10100 |
| PSA | 17.07000 |
| LogP | 4.17040 |
| Vapour Pressure | 7.74E-06mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | MWVYAXLUWZOOLT-UHFFFAOYSA-N |
| SMILES | O=C(CCCc1ccc(F)cc1)c1ccc(F)cc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| einecs 241-193-3 |