1-fluoro-4-[(4-fluorophenyl)-phenylphosphoryl]benzene structure
|
Common Name | 1-fluoro-4-[(4-fluorophenyl)-phenylphosphoryl]benzene | ||
|---|---|---|---|---|
| CAS Number | 54300-32-2 | Molecular Weight | 314.26600 | |
| Density | 1.28 g/cm3 | Boiling Point | 454.5ºC at 760 mmHg | |
| Molecular Formula | C18H13F2OP | Melting Point | 125-131ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 228.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-fluoro-4-[(4-fluorophenyl)-phenylphosphoryl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28 g/cm3 |
|---|---|
| Boiling Point | 454.5ºC at 760 mmHg |
| Melting Point | 125-131ºC(lit.) |
| Molecular Formula | C18H13F2OP |
| Molecular Weight | 314.26600 |
| Flash Point | 228.7ºC |
| Exact Mass | 314.06700 |
| PSA | 26.88000 |
| LogP | 3.60420 |
| Index of Refraction | 1.593 |
| InChIKey | AAYLOGMTTMROGA-UHFFFAOYSA-N |
| SMILES | O=P(c1ccccc1)(c1ccc(F)cc1)c1ccc(F)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | R20/21/22 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2903999090 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| EINECS 259-079-7 |
| 4,4'-difluorotriphenylphosphine oxide |
| MFCD00239478 |