trimethoxy-7-oxabicyclo[4.1.0]hept-3-ylsilane structure
|
Common Name | trimethoxy-7-oxabicyclo[4.1.0]hept-3-ylsilane | ||
|---|---|---|---|---|
| CAS Number | 17139-83-2 | Molecular Weight | 218.32200 | |
| Density | 1.07g/cm3 | Boiling Point | 241.1ºC at 760mmHg | |
| Molecular Formula | C9H18O4Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 76ºC | |
| Name | trimethoxy(7-oxabicyclo[4.1.0]heptan-4-yl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 241.1ºC at 760mmHg |
| Molecular Formula | C9H18O4Si |
| Molecular Weight | 218.32200 |
| Flash Point | 76ºC |
| Exact Mass | 218.09700 |
| PSA | 40.22000 |
| LogP | 1.18600 |
| Vapour Pressure | 0.0567mmHg at 25°C |
| Index of Refraction | 1.457 |
| InChIKey | ZQDWUJIBGXKPDZ-UHFFFAOYSA-N |
| SMILES | CO[Si](OC)(OC)C1CCC2OC2C1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 241-198-0 |
| 1-trimethoxysilyl-3,4-epoxycyclohexane |