2-(3,4 epoxycyclohexyl)ethyltrimethoxysilane structure
|
Common Name | 2-(3,4 epoxycyclohexyl)ethyltrimethoxysilane | ||
|---|---|---|---|---|
| CAS Number | 3388-04-3 | Molecular Weight | 246.376 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 263.5±13.0 °C at 760 mmHg | |
| Molecular Formula | C11H22O4Si | Melting Point | <0ºC | |
| MSDS | Chinese USA | Flash Point | 89.7±20.2 °C | |
| Symbol |
GHS08 |
Signal Word | Danger | |
| Name | Trimethoxy[2-(7-oxabicyclo[4.1.0]hept-3-yl)ethyl]silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 263.5±13.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C11H22O4Si |
| Molecular Weight | 246.376 |
| Flash Point | 89.7±20.2 °C |
| Exact Mass | 246.128738 |
| PSA | 40.22000 |
| LogP | 1.28 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.454 |
| InChIKey | DQZNLOXENNXVAD-UHFFFAOYSA-N |
| SMILES | CO[Si](CCC1CCC2OC2C1)(OC)OC |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H350 |
| Precautionary Statements | P201-P308 + P313 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T:Toxic; |
| Risk Phrases | R45;R46 |
| Safety Phrases | S53-S23-S36/37/39-S45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | VV4000000 |
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
[Preparation and evaluation of alkyl ether-bonded phase for reversed-phase high performance liquid chromatography].
Se Pu 19(6) , 485-8, (2001) A new silane coupling agent, beta-(3,4-epoxycyclohexyl)ethyltrimethoxy silane, was for the firsty time used to react with octanol, then the intermediate product was coupled onto porous silica to obtai... |
|
|
Evaluation of the developmental toxicity of beta-(3,4-epoxycyclohexyl)ethyltrimethoxysilane in Fischer 344 rats and New Zealand white rabbits.
Fundam. Appl. Toxicol. 10(3) , 439-52, (1988) beta-(3,4-epoxycyclohexyl)ethyltrimethoxysilane (ECEMS, CAS No. 3388-04-3) is mutagenic in vitro and weakly carcinogenic in mice after dermal application. Timed pregnant Fischer 344 rats and New Zeala... |
|
|
Design and application of high-sensitivity two-photon initiators for three-dimensional microfabrication.
J. Photochem. Photobiol. A: Chem. 158(2) , 163-170, (2003)
|
| 4-[2-(Trimethoxysilyl)ethyl]-7-oxabicyclo[4.1.0]heptane |
| CE6250 |
| Trimethoxy[2-(7-oxabicyclo[4.1.0]hept-3-yl)ethyl]silane |
| (2-(7-Oxabicyclo[4.1.0]heptan-3-yl)ethyl)trimethoxysilane |
| EINECS 222-217-1 |
| trimethoxy[2-(7-oxabicyclo[4.1.0]-hept-3-yl)ethyl]silane |
| s530 |
| Trimethoxy[2-(7-oxabicyclo[4.1.0]hept-3-yl)ethyl]silane |
| 2-(2,2,3,4,4,4-HEXAFLUOROBUTOXY)ETHANOL |
| MFCD00014485 |
| Silane, trimethoxy[2- (7-oxabicyclo[4.1.0]hept-3-yl)ethyl]- |
| 2-(3,4-Epoxycyclohexyl)Ethyltrimethoxysilane |
| NUCA 186 |
| Silane, [β-(3,4-epoxycyclohexyl)ethyl]trimethoxy- |
| y4086 |
| KBM 303 |
| A 186 |
| e6250 |
| 2-(3,4 epoxycyclohexyl)ethyltrimethoxysilane |
| 3-[2-(Trimethoxysilyl)ethyl]-7-oxabicyclo[4.1.0]heptane |
| Silane, trimethoxy[2-(7-oxabicyclo[4.1.0]hept-3-yl)ethyl]- |