Tris[2-(diethylamino)ethoxy]phenylsilane structure
|
Common Name | Tris[2-(diethylamino)ethoxy]phenylsilane | ||
|---|---|---|---|---|
| CAS Number | 17146-76-8 | Molecular Weight | 453.73400 | |
| Density | 0.99g/cm3 | Boiling Point | 474.2ºC at 760 mmHg | |
| Molecular Formula | C24H47N3O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.6ºC | |
| Name | 2-[bis[2-(diethylamino)ethoxy]-phenylsilyl]oxy-N,N-diethylethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 474.2ºC at 760 mmHg |
| Molecular Formula | C24H47N3O3Si |
| Molecular Weight | 453.73400 |
| Flash Point | 240.6ºC |
| Exact Mass | 453.33900 |
| PSA | 37.41000 |
| LogP | 2.90770 |
| Vapour Pressure | 3.67E-09mmHg at 25°C |
| Index of Refraction | 1.506 |
| InChIKey | AODUXVBVLDHNPO-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCO[Si](OCCN(CC)CC)(OCCN(CC)CC)c1ccccc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Tris-<2-diethylamino-ethoxy>-phenyl-silan |