3-methyl-2-(morpholin-4-ylmethyl)-6-propan-2-ylphenol structure
|
Common Name | 3-methyl-2-(morpholin-4-ylmethyl)-6-propan-2-ylphenol | ||
|---|---|---|---|---|
| CAS Number | 1715-74-8 | Molecular Weight | 249.34900 | |
| Density | 1.076g/cm3 | Boiling Point | 355.8ºC at 760 mmHg | |
| Molecular Formula | C15H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169ºC | |
| Name | 3-methyl-2-(morpholin-4-ylmethyl)-6-propan-2-ylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.076g/cm3 |
|---|---|
| Boiling Point | 355.8ºC at 760 mmHg |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.34900 |
| Flash Point | 169ºC |
| Exact Mass | 249.17300 |
| PSA | 32.70000 |
| LogP | 2.59410 |
| Vapour Pressure | 1.49E-05mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | DPRXSDSQZAMXLI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(C)C)c(O)c1CN1CCOCC1 |
|
~28%
Detail
|
| Literature: Dwivedi; Shukla; Bhandari; Setty; Kamboj; Khanna Indian Journal of Chemistry - Section B Organic Chemistry Including Medicinal Chemistry, 1991 , vol. 30, # 2 p. 281 - 285 |
|
~%
3-methyl-2-(mor... CAS#:1715-74-8 |
| Literature: Giannini,M.; Fedi,M. Farmaco, Edizione Scientifica, 1965 , vol. 20, p. 176 - 193 |
| 6-isopropyl-3-methyl-2-morpholin-4-ylmethyl-phenol |