2-(4-acetylphenoxy)-N-(2-methylphenyl)acetamide structure
|
Common Name | 2-(4-acetylphenoxy)-N-(2-methylphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 17172-81-5 | Molecular Weight | 283.32200 | |
| Density | 1.186g/cm3 | Boiling Point | 512.9ºC at 760mmHg | |
| Molecular Formula | C17H17NO3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 264ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(4-acetylphenoxy)-N-(2-methylphenyl)acetamide |
|---|
| Density | 1.186g/cm3 |
|---|---|
| Boiling Point | 512.9ºC at 760mmHg |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.32200 |
| Flash Point | 264ºC |
| Exact Mass | 283.12100 |
| PSA | 58.89000 |
| LogP | 3.86460 |
| Vapour Pressure | 1.25E-10mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | VJPRCFLNXLDXPZ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(OCC(=O)Nc2ccccc2C)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |