methyl 2-(2-acetyl-4,5-dimethoxyphenyl)acetate structure
|
Common Name | methyl 2-(2-acetyl-4,5-dimethoxyphenyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 17173-27-2 | Molecular Weight | 252.26300 | |
| Density | 1.137g/cm3 | Boiling Point | 376.1ºC at 760mmHg | |
| Molecular Formula | C13H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.4ºC | |
| Name | methyl 2-(2-acetyl-4,5-dimethoxyphenyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.137g/cm3 |
|---|---|
| Boiling Point | 376.1ºC at 760mmHg |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.26300 |
| Flash Point | 198.4ºC |
| Exact Mass | 252.10000 |
| PSA | 61.83000 |
| LogP | 1.62190 |
| Vapour Pressure | 7.44E-06mmHg at 25°C |
| Index of Refraction | 1.503 |
| InChIKey | GJRQPRICGHKGAS-UHFFFAOYSA-N |
| SMILES | COC(=O)Cc1cc(OC)c(OC)cc1C(C)=O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| HMS559J15 |
| 2-acetyl homoveratric acid methylester |
| 2-Acetyl-4,5-dimethoxy-phenylessigsaeure-methylester |
| (2-acetyl-4,5-dimethoxy-phenyl)-acetic acid methyl ester |