Carbonic acid (p-bromophenyl)phenyl ester structure
|
Common Name | Carbonic acid (p-bromophenyl)phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 17175-13-2 | Molecular Weight | 293.11300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-(4-bromophenyl)phenyl] hydrogen carbonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H9BrO3 |
|---|---|
| Molecular Weight | 293.11300 |
| Exact Mass | 291.97400 |
| PSA | 46.53000 |
| LogP | 4.17290 |
| InChIKey | QJIIDPHMUCQDEP-UHFFFAOYSA-N |
| SMILES | O=C(O)Oc1ccccc1-c1ccc(Br)cc1 |
| HS Code | 2920909090 |
|---|
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Carbonic acid (p-bromophenyl)phenyl ester |