Carbonic acid, p-methoxyphenyl phenyl ester structure
|
Common Name | Carbonic acid, p-methoxyphenyl phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 17145-95-8 | Molecular Weight | 244.24300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methoxyphenyl phenyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12O4 |
|---|---|
| Molecular Weight | 244.24300 |
| Exact Mass | 244.07400 |
| PSA | 44.76000 |
| LogP | 3.27300 |
| InChIKey | CDYRJVLCQQLYLL-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC(=O)Oc2ccccc2)cc1 |
| HS Code | 2920909090 |
|---|
|
~%
Carbonic acid, ... CAS#:17145-95-8 |
| Literature: Copeland, Christopher; Stick, Robert V. Australian Journal of Chemistry, 1984 , vol. 37, # 7 p. 1483 - 1487 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| p-Methoxyphenyl-phenylcarbonat |
| p-methoxyphenyl phenyl carbonate |