N-Boc-N'-[(Allyloxy)carbonyl]-L-ornithine structure
|
Common Name | N-Boc-N'-[(Allyloxy)carbonyl]-L-ornithine | ||
|---|---|---|---|---|
| CAS Number | 171820-74-9 | Molecular Weight | 316.35000 | |
| Density | 1.153g/cm3 | Boiling Point | 504.9ºC at 760 mmHg | |
| Molecular Formula | C14H24N2O6 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 259.1ºC | |
| Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(prop-2-enoxycarbonylamino)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.153g/cm3 |
|---|---|
| Boiling Point | 504.9ºC at 760 mmHg |
| Molecular Formula | C14H24N2O6 |
| Molecular Weight | 316.35000 |
| Flash Point | 259.1ºC |
| Exact Mass | 316.16300 |
| PSA | 113.96000 |
| LogP | 2.43850 |
| Vapour Pressure | 1.46E-11mmHg at 25°C |
| Index of Refraction | 1.486 |
| InChIKey | OSIUYHBPBBOKMJ-JTQLQIEISA-N |
| SMILES | C=CCOC(=O)NCCCC(NC(=O)OC(C)(C)C)C(=O)O |
| Storage condition | -15°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924199090 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| AmbotzBAA1119 |
| N|A-Alloc-N|A-Boc-L-ornithine |
| Nalpha-Boc-Ndelta-Alloc-L-ornithine |
| (S)-5-(((Allyloxy)carbonyl)amino)-2-((tert-butoxycarbonyl)amino)pentanoic acid |
| Ndelta-Alloc-Nalpha-Boc-L-ornithine |
| N|A-Boc-N|A-Alloc-L-ornithine |
| N-Boc-N'-[(Allyloxy)carbonyl]-L-ornithine |
| Boc-Orn(Aloc)-OH |