Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic acid dianhydride structure
|
Common Name | Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic acid dianhydride | ||
|---|---|---|---|---|
| CAS Number | 1719-83-1 | Molecular Weight | 248.188 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 546.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C12H8O6 | Melting Point | >300 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 250.7±30.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic acid dianhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 546.8±50.0 °C at 760 mmHg |
| Melting Point | >300 °C(lit.) |
| Molecular Formula | C12H8O6 |
| Molecular Weight | 248.188 |
| Flash Point | 250.7±30.2 °C |
| Exact Mass | 248.032089 |
| PSA | 86.74000 |
| LogP | -1.00 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | XLOGCGOPKPCECW-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)C2C3C=CC(C12)C1C(=O)OC(=O)C31 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932190090 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4,10-Dioxatetracyclo[5.5.2.0.0]tetradec-13-ene-3,5,9,11-tetrone |
| Bicyclo[2.2.2]-7-octene-2,3,5,6-tetracarboxylic Dianhydride |
| 4,8-Etheno-1H,3H-benzo[1,2-c:4,5-c']difuran-1,3,5,7-tetrone, 3a,4,4a,7a,8,8a-hexahydro- |
| Hexahydro-1H,3H-4,8-ethenobenzo[1,2-c:4,5-c']difuran-1,3,5,7-tetrone |
| 4,4a,8,8a-Tetrahydro-4,8-ethenobenzo[1,2-c:4,5-c']difuran-1,3,5,7(3aH,7aH)-tetraone |
| MFCD00082228 |
| Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic Dianhydride |
| EINECS 217-009-2 |