4-Carboxybenzenesulfonazide structure
|
Common Name | 4-Carboxybenzenesulfonazide | ||
|---|---|---|---|---|
| CAS Number | 17202-49-2 | Molecular Weight | 227.19700 | |
| Density | 1.6556 (rough estimate) | Boiling Point | N/A | |
| Molecular Formula | C7H5N3O4S | Melting Point | 180ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-azidosulfonylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6556 (rough estimate) |
|---|---|
| Melting Point | 180ºC (dec.)(lit.) |
| Molecular Formula | C7H5N3O4S |
| Molecular Weight | 227.19700 |
| Exact Mass | 227.00000 |
| PSA | 129.57000 |
| LogP | 1.91736 |
| Index of Refraction | 1.6320 (estimate) |
| InChIKey | OWULJVXJAZBQLL-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NS(=O)(=O)c1ccc(C(=O)O)cc1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2929909090 |
|
~51%
4-Carboxybenzen... CAS#:17202-49-2 |
| Literature: Wolfe; Ro; Shi Canadian Journal of Chemistry, 2001 , vol. 79, # 8 p. 1259 - 1271 |
|
~%
4-Carboxybenzen... CAS#:17202-49-2 |
| Literature: Journal of Organic Chemistry, , vol. 33, # 9 p. 3610 - 3618 |
| HS Code | 2929909090 |
|---|---|
| Summary | 2929909090 other compounds with other nitrogen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-carboxybenzenesulphonyl azide |
| Benzoic acid,4-(azidosulfonyl) |
| 4-carboxybenzenesulfonyl azide |
| p-carboxyphenylsulfonyl azide |
| 4-carboxyphenylsulfonyl azide |
| p-carboxybenzenesulfonyl azide |
| 4-carboxybenzenesulfonazide |
| 3-[(4-carboxyphenyl)sulfonyl]triaza-1,2-dien-2-ium-1-ide |
| 4-(azidosulfonyl)benzoic acid |
| MFCD00041753 |