Glycine, N-((2,4-dichlorophenoxy)acetyl)- structure
|
Common Name | Glycine, N-((2,4-dichlorophenoxy)acetyl)- | ||
|---|---|---|---|---|
| CAS Number | 17212-10-1 | Molecular Weight | 278.08900 | |
| Density | 1.483g/cm3 | Boiling Point | 549.1ºC at 760mmHg | |
| Molecular Formula | C10H9Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.9ºC | |
| Name | Glycine, N-((2,4-dichlorophenoxy)acetyl) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.483g/cm3 |
|---|---|
| Boiling Point | 549.1ºC at 760mmHg |
| Molecular Formula | C10H9Cl2NO4 |
| Molecular Weight | 278.08900 |
| Flash Point | 285.9ºC |
| Exact Mass | 276.99100 |
| PSA | 75.63000 |
| LogP | 1.96390 |
| Vapour Pressure | 6.87E-13mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | ZSUWKPLZWNKGFI-UHFFFAOYSA-N |
| SMILES | O=C(O)CNC(=O)COc1ccc(Cl)cc1Cl |
| HS Code | 2924299090 |
|---|
|
~%
Glycine, N-((2,... CAS#:17212-10-1 |
| Literature: Lopez-Villalobos, Arturo; Hornung, Roland; Dodds, Peter F. Phytochemistry, 2004 , vol. 65, # 20 p. 2763 - 2774 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,4-dichlorophenoxyacetylglycine |