(S)-Fmoc-4-Br-HomoAla-OH structure
|
Common Name | (S)-Fmoc-4-Br-HomoAla-OH | ||
|---|---|---|---|---|
| CAS Number | 172169-88-9 | Molecular Weight | 404.25500 | |
| Density | N/A | Boiling Point | 594.003ºC at 760 mmHg | |
| Molecular Formula | C19H18BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 313.042ºC | |
| Name | (S)-Fmoc-2-Amino-4-bromobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 594.003ºC at 760 mmHg |
|---|---|
| Molecular Formula | C19H18BrNO4 |
| Molecular Weight | 404.25500 |
| Flash Point | 313.042ºC |
| Exact Mass | 403.04200 |
| PSA | 75.63000 |
| LogP | 4.15420 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | WRUVVOOOVOSSKP-KRWDZBQOSA-N |
| SMILES | O=C(NC(CCBr)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-bromobutanoic acid |