Oleanolic acid derivative 1 structure
|
Common Name | Oleanolic acid derivative 1 | ||
|---|---|---|---|---|
| CAS Number | 1724-18-1 | Molecular Weight | 452.712 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 503.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C31H48O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.1±17.7 °C | |
Use of Oleanolic acid derivative 1Oleanolic acid derivative 1 is an oleanolic acid derivative, which is a novel triterpenoid-steroid hybrid molecule. |
| Name | Oleanolic acid derivative 1 |
|---|---|
| Synonym | More Synonyms |
| Description | Oleanolic acid derivative 1 is an oleanolic acid derivative, which is a novel triterpenoid-steroid hybrid molecule. |
|---|---|
| Related Catalog | |
| In Vitro | Oleanolic acid suppress transcription or translation of inducible nitric oxide synthase (iNOS) and inducible cyclooxygenase (COX-2) genes. HY-18002 is extracted from the reference, compound 9a. In the strategy, it was ambiguous whether phosphorus pentachloride (PCl5) would give the desired ring contraction product 9a (HY-18002) in the first step according to classical procedures[1]. |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 503.3±50.0 °C at 760 mmHg |
| Molecular Formula | C31H48O2 |
| Molecular Weight | 452.712 |
| Flash Point | 255.1±17.7 °C |
| Exact Mass | 452.365417 |
| LogP | 11.13 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.540 |
| InChIKey | IOPWKRLDGMBGCA-BUESHWSCSA-N |
| SMILES | COC(=O)C12CCC(C)(C)CC1C1=CCC3C4(C)CCC(=C(C)C)C4CCC3(C)C1(C)CC2 |
| Storage condition | 2-8℃ |
| Methyl (3aR,5aR,5bS,7aS,11aS,13aR,13bS)-3-isopropylidene-5a,5b,10,10,13b-pentamethyl-1,2,3,3a,4,5,5a,5b,6,7,8,9,10,11,11a,13,13a,13b-octadecahydro-7aH-cyclopenta[a]chrysene-7a-carboxylate |
| 7aH-Cyclopenta[a]chrysene-7a-carboxylic acid, 1,2,3,3a,4,5,5a,5b,6,7,8,9,10,11,11a,13,13a,13b-octadecahydro-5a,5b,10,10,13b-pentamethyl-3-(1-methylethylidene)-, methyl ester, (3aR,5aR,5bS,7aS,11aS,13aR,13bS)- |