tert-Butyl methyl(pyrrolidin-3-yl)carbamate structure
|
Common Name | tert-Butyl methyl(pyrrolidin-3-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 172478-00-1 | Molecular Weight | 200.278 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 268.3±29.0 °C at 760 mmHg | |
| Molecular Formula | C10H20N2O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 116.0±24.3 °C | |
| Name | 3-(N-Boc-N-methylamino)pyrrolidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 268.3±29.0 °C at 760 mmHg |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.278 |
| Flash Point | 116.0±24.3 °C |
| Exact Mass | 200.152481 |
| PSA | 41.57000 |
| LogP | 1.12 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.486 |
| InChIKey | XYKYUXYNQDXZTD-UHFFFAOYSA-N |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCNC1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2933990090 |
|
~92%
tert-Butyl meth... CAS#:172478-00-1 |
| Literature: Barlocco, Daniela; Villa, Stefania; Fratta, Walter; Fadda, Paola; Colombo, Diego; Toma, Lucio Tetrahedron, 1995 , vol. 51, # 42 p. 11547 - 11556 |
|
~%
tert-Butyl meth... CAS#:172478-00-1 |
| Literature: Tetrahedron, , vol. 51, # 42 p. 11547 - 11556 |
|
~%
tert-Butyl meth... CAS#:172478-00-1 |
| Literature: Tetrahedron, , vol. 51, # 42 p. 11547 - 11556 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-2-propanyl methyl(3-pyrrolidinyl)carbamate |
| 3-N-Boc-3-N-Methylaminopyrrolidine |
| tert-butyl N-methyl-N-pyrrolidin-3-ylcarbamate |
| Carbamic acid, N-methyl-N-3-pyrrolidinyl-, 1,1-dimethylethyl ester |
| tert-Butyl methyl(pyrrolidin-3-yl)carbamate |
| 3-(N-tert-Butoxycarbonyl-N-MethylaMino)pyrrolidine |
| MFCD00191665 |
| 3-N-Boc-3-N-methyl amino pyrrolidine |