Phosphine oxide,triheptyl- structure
|
Common Name | Phosphine oxide,triheptyl- | ||
|---|---|---|---|---|
| CAS Number | 17262-51-0 | Molecular Weight | 344.55500 | |
| Density | 0.862g/cm3 | Boiling Point | 468.2ºC at 760 mmHg | |
| Molecular Formula | C21H45OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237ºC | |
| Name | 1-diheptylphosphorylheptane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.862g/cm3 |
|---|---|
| Boiling Point | 468.2ºC at 760 mmHg |
| Molecular Formula | C21H45OP |
| Molecular Weight | 344.55500 |
| Flash Point | 237ºC |
| Exact Mass | 344.32100 |
| PSA | 26.88000 |
| LogP | 8.26070 |
| Vapour Pressure | 1.71E-08mmHg at 25°C |
| Index of Refraction | 1.444 |
| InChIKey | KNFWHHCXXKWASF-UHFFFAOYSA-N |
| SMILES | CCCCCCCP(=O)(CCCCCCC)CCCCCCC |
|
~%
Phosphine oxide... CAS#:17262-51-0 |
| Literature: Jackson; Davies; Jones Journal of the Chemical Society, 1931 , p. 2109,2111 |
|
~%
Phosphine oxide... CAS#:17262-51-0 |
| Literature: Jackson; Davies; Jones Journal of the Chemical Society, 1931 , p. 2109,2111 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| triheptylphosphine oxide |
| Triheptyl-phosphinoxid |
| T0500-5747 |