Phosphine oxide,tris(2-ethylhexyl)- structure
|
Common Name | Phosphine oxide,tris(2-ethylhexyl)- | ||
|---|---|---|---|---|
| CAS Number | 2785-32-2 | Molecular Weight | 386.63500 | |
| Density | 0.859g/cm3 | Boiling Point | 494.9ºC at 760mmHg | |
| Molecular Formula | C24H51OP | Melting Point | N/A | |
| MSDS | USA | Flash Point | 253.1ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 3-[bis(2-ethylhexyl)phosphorylmethyl]heptane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.859g/cm3 |
|---|---|
| Boiling Point | 494.9ºC at 760mmHg |
| Molecular Formula | C24H51OP |
| Molecular Weight | 386.63500 |
| Flash Point | 253.1ºC |
| Exact Mass | 386.36800 |
| PSA | 26.88000 |
| LogP | 8.99870 |
| Vapour Pressure | 1.88E-09mmHg at 25°C |
| Index of Refraction | 1.445 |
| InChIKey | RKJGHINMWRVRJW-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)CP(=O)(CC(CC)CCCC)CC(CC)CCCC |
| Storage condition | 2-8°C |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | 38-41 |
| Safety Phrases | 26-39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2901100000 |
| HS Code | 2901100000 |
|---|---|
| Summary | 2901100000 saturated acyclic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
|
Tris(2-ethylhexyl)phosphine oxide as an effective solvent mediator for constructing a serotonin-selective membrane electrode K. Ueda et al.
Anal. Chim. Acta 565 , 36, (2006)
|
| tri(2-ethylhexyl)phosphine oxide |
| Tri-(2-ethylhexyl)-phosphinoxid |
| Tris-(2-ethyl-hexyl)-phosphinoxid |
| Tris(2-ethylhexyl)phosphine oxide |
| tris(2-ethylhexyl)phosphane oxide |