(4-Nitro-benzylamino)-acetic acid structure
|
Common Name | (4-Nitro-benzylamino)-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 1727-14-6 | Molecular Weight | 210.18700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(4-nitrophenyl)methylamino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H10N2O4 |
|---|---|
| Molecular Weight | 210.18700 |
| Exact Mass | 210.06400 |
| PSA | 95.15000 |
| LogP | 1.68310 |
| InChIKey | WNQZQOVOWAVAHI-UHFFFAOYSA-N |
| SMILES | O=C(O)CNCc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2922499990 |
|---|
|
~%
(4-Nitro-benzyl... CAS#:1727-14-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 43, # 9 p. 1858 - 1865 |
|
~%
(4-Nitro-benzyl... CAS#:1727-14-6 |
| Literature: Roczniki Chemii, , vol. 39, p. 317 - 321 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| N-(4-Nitrobenzyl)glycin |
| N-4-nitrobenzylglycine |
| (4-nitrobenzylamino)acetic acid |