4-Nitrobenzyl chloride structure
|
Common Name | 4-Nitrobenzyl chloride | ||
|---|---|---|---|---|
| CAS Number | 100-14-1 | Molecular Weight | 171.581 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 292.5±15.0 °C at 760 mmHg | |
| Molecular Formula | C7H6ClNO2 | Melting Point | 71 °C | |
| MSDS | Chinese USA | Flash Point | 130.7±20.4 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | p-nitrobenzyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 292.5±15.0 °C at 760 mmHg |
| Melting Point | 71 °C |
| Molecular Formula | C7H6ClNO2 |
| Molecular Weight | 171.581 |
| Flash Point | 130.7±20.4 °C |
| Exact Mass | 171.008713 |
| PSA | 45.82000 |
| LogP | 2.22 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | KGCNHWXDPDPSBV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CCl)cc1 |
| Stability | Stable. Incompatible with strong oxidizing agents, bases, amines, moisture, alcohols. Corrodes steel. Reacts slowly with water. Combustible. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive |
| Risk Phrases | R22;R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | XS9093000 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2904909090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
A heme model system for the reduction of substrates by microsomal cytochrome P 450.
Biochem. Biophys. Res. Commun. 104(4) , 1651-7, (1982)
|
|
|
A case of multiple sensitization to three halogeno-substituted mono-nitrobenzenes.
Ital. Gen. Rev. Dermatol. 15(2) , 107-12, (1978) A case of occupational contact dermatitis in a female chemical pharmaceutical laboratory researcher is described. The allergological investigation revealed a state of sensitization to three mono-nitro... |
|
|
Hepatic and branchial glutathione S-transferases of two fish species: substrate specificity and biotransformation of microcystin-LR.
Comp. Biochem. Physiol. C. Toxicol. Pharmacol. 149(4) , 515-23, (2009) Liver and gills of roach (Rutilus rutilus) and silver carp (Hypophthalmichthys molitrix) were examined for glutathione S-transferases (GSTs) contents and their substrate specificity and capacity to bi... |
| α-Chloro-4-nitrotoluene |
| Benzene, 1- (chloromethyl)-4-nitro- |
| Toluene, α-chloro-p-nitro- |
| α-Chloro-p-nitrotoluene |
| EINECS 202-822-7 |
| MFCD00007374 |
| 4-Nitrobenzyl chloride |
| Benzene, 1-(chloromethyl)-4-nitro- |
| 1-(Chloromethyl)-4-nitrobenzene |