2-(3-Methoxypropoxy)-4-((R)-2-(bromomethyl)-3-methylbutyl)-1-methoxybenzene) structure
|
Common Name | 2-(3-Methoxypropoxy)-4-((R)-2-(bromomethyl)-3-methylbutyl)-1-methoxybenzene) | ||
|---|---|---|---|---|
| CAS Number | 172900-69-5 | Molecular Weight | 359.298 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 398.8±32.0 °C at 760 mmHg | |
| Molecular Formula | C17H27BrO3 | Melting Point | 52-53ºC | |
| MSDS | N/A | Flash Point | 164.4±23.6 °C | |
| Name | 2-(3-Methoxypropoxy)-4-((R)-2-(bromomethyl)-3-methylbutyl)-1-methoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 398.8±32.0 °C at 760 mmHg |
| Melting Point | 52-53ºC |
| Molecular Formula | C17H27BrO3 |
| Molecular Weight | 359.298 |
| Flash Point | 164.4±23.6 °C |
| Exact Mass | 358.114349 |
| PSA | 27.69000 |
| LogP | 4.72 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.506 |
| InChIKey | ICJBMWOVLFPLFP-HNNXBMFYSA-N |
| SMILES | COCCCOc1cc(CC(CBr)C(C)C)ccc1OC |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2909309090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene, 4-[(2R)-2-(bromomethyl)-3-methylbutyl]-1-methoxy-2-(3-methoxypropoxy)- |
| 4-[(2R)-2-(Bromomethyl)-3-methylbutyl]-1-methoxy-2-(3-methoxypropoxy)benzene |