[1,1'-Biphenyl]-2-carboxylicacid, 2'-nitro structure
|
Common Name | [1,1'-Biphenyl]-2-carboxylicacid, 2'-nitro | ||
|---|---|---|---|---|
| CAS Number | 17294-89-2 | Molecular Weight | 243.21500 | |
| Density | 1.358g/cm3 | Boiling Point | 405.3ºC at 760 mmHg | |
| Molecular Formula | C13H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.5ºC | |
| Name | 2-(2-nitrophenyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.358g/cm3 |
|---|---|
| Boiling Point | 405.3ºC at 760 mmHg |
| Molecular Formula | C13H9NO4 |
| Molecular Weight | 243.21500 |
| Flash Point | 173.5ºC |
| Exact Mass | 243.05300 |
| PSA | 83.12000 |
| LogP | 3.48320 |
| Vapour Pressure | 2.69E-07mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | OBCFFNURIFARKS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1-c1ccccc1[N+](=O)[O-] |
| Precursor 10 | |
|---|---|
| DownStream 7 | |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| 2'-Nitro-biphenyl-2-carbonsaeure |
| 2'-nitro-biphenyl-2-carboxylic acid |
| [1,2'-nitro |
| 2-(1-PHENYLETHYLIDENE)MALONONITRILE |