2'-nitro[1,1'-biphenyl]-2-carbaldehyde
![2'-nitro[1,1'-biphenyl]-2-carbaldehyde Structure](https://image.chemsrc.com/caspic/324/68182-83-2.png)
2'-nitro[1,1'-biphenyl]-2-carbaldehyde structure
|
Common Name | 2'-nitro[1,1'-biphenyl]-2-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 68182-83-2 | Molecular Weight | 227.21500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2'-nitro[1,1'-biphenyl]-2-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H9NO3 |
|---|---|
| Molecular Weight | 227.21500 |
| Exact Mass | 227.05800 |
| PSA | 62.89000 |
| LogP | 3.59750 |
| InChIKey | OTPITYJXOMULCO-UHFFFAOYSA-N |
| SMILES | O=Cc1ccccc1-c1ccccc1[N+](=O)[O-] |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:229-87-8![[1,1'-Biphenyl]-2-carboxylicacid, 2'-nitro structure](https://image.chemsrc.com/caspic/100/17294-89-2.png)
CAS#:17294-89-2
CAS#:72391-95-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Formyl-2'-nitrobiphenyl |
| 2-Nitrop-2'-formyl-diphenyl |
| 2'-nitrobiphenyl-2-carbaldehyde |
| 2-Nitro-2'-biphenylcarboxaldehyd |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2'-nitro[1,1'-biphenyl]-2-carbaldehyde? |
| A: CAS number of 2'-nitro[1,1'-biphenyl]-2-carbaldehyde is 68182-83-2. |
| Q: What is the English name of 2'-nitro[1,1'-biphenyl]-2-carbaldehyde? |
| A: The English name of 2'-nitro[1,1'-biphenyl]-2-carbaldehyde is 2'-nitro[1,1'-biphenyl]-2-carbaldehyde. |
| Q: What is the molecular weight of 2'-nitro[1,1'-biphenyl]-2-carbaldehyde? |
| A: Molecular weight of 2'-nitro[1,1'-biphenyl]-2-carbaldehyde is 227.21500. |
| Q: What is the InChIKey of 2'-nitro[1,1'-biphenyl]-2-carbaldehyde? |
| A: InChIKey of 2'-nitro[1,1'-biphenyl]-2-carbaldehyde is OTPITYJXOMULCO-UHFFFAOYSA-N. |
| Q: What are the downstream products of 2'-nitro[1,1'-biphenyl]-2-carbaldehyde? |
| A: Related downstream products(CAS) of 2'-nitro[1,1'-biphenyl]-2-carbaldehyde: 229-87-8;17294-89-2;72391-95-8. |
| Q: What English synonyms does 2'-nitro[1,1'-biphenyl]-2-carbaldehyde have? |
| A: English synonyms of 2'-nitro[1,1'-biphenyl]-2-carbaldehyde: 2-Formyl-2'-nitrobiphenyl, 2-Nitrop-2'-formyl-diphenyl, 2'-nitrobiphenyl-2-carbaldehyde, 2-Nitro-2'-biphenylcarboxaldehyd. |
| Q: What is the SMILES notation of 2'-nitro[1,1'-biphenyl]-2-carbaldehyde? |
| A: SMILES notation of 2'-nitro[1,1'-biphenyl]-2-carbaldehyde is O=Cc1ccccc1-c1ccccc1[N+](=O)[O-]. |
| Q: What is the polar surface area (PSA) of 2'-nitro[1,1'-biphenyl]-2-carbaldehyde? |
| A: Polar surface area (PSA) of 2'-nitro[1,1'-biphenyl]-2-carbaldehyde is 62.89000. |
| Q: What is the molecular formula of 2'-nitro[1,1'-biphenyl]-2-carbaldehyde? |
| A: Molecular formula of 2'-nitro[1,1'-biphenyl]-2-carbaldehyde is C13H9NO3. |
| Q: What is the Chinese name of 68182-83-2? |
| A: Chinese name of 68182-83-2 is 68182-83-2. |