Garciniaxanthone E structure
|
Common Name | Garciniaxanthone E | ||
|---|---|---|---|---|
| CAS Number | 173294-74-1 | Molecular Weight | 464.550 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 692.8±55.0 °C at 760 mmHg | |
| Molecular Formula | C28H32O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.9±25.0 °C | |
Use of Garciniaxanthone EGarciniaxanthone E is a xanthone compound. Garciniaxanthone E significantly enhances cellular nerve growth factor (NGF)-mediated neurite outgrowth in PC12D cells. Garciniaxanthone E contributes to basic research and medicinal development in neurodegenerative diseases[1]. |
| Name | 2-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-3,4,6,8-tetrahydroxy-1-(3 -methyl-2-buten-1-yl)-9H-xanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Description | Garciniaxanthone E is a xanthone compound. Garciniaxanthone E significantly enhances cellular nerve growth factor (NGF)-mediated neurite outgrowth in PC12D cells. Garciniaxanthone E contributes to basic research and medicinal development in neurodegenerative diseases[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Iwagawa T, et al. Monoterpenoids from Radermachia sinica[J]. Phytochemistry, 1990, 29(6): 1913-1916. |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 692.8±55.0 °C at 760 mmHg |
| Molecular Formula | C28H32O6 |
| Molecular Weight | 464.550 |
| Flash Point | 229.9±25.0 °C |
| Exact Mass | 464.219879 |
| PSA | 111.13000 |
| LogP | 6.97 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | BRKFTRQHPIQVNO-LICLKQGHSA-N |
| SMILES | CC(C)=CCCC(C)=CCc1c(O)c(O)c2oc3cc(O)cc(O)c3c(=O)c2c1CC=C(C)C |
| Hazard Codes | Xi |
|---|
| 2-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-3,4,6,8-tetrahydroxy-1-(3-methyl-2-buten-1-yl)-9H-xanthen-9-one |
| 9H-Xanthen-9-one, 2-[(2E)-3,7-dimethyl-2,6-octadien-1-yl]-3,4,6,8-tetrahydroxy-1-(3-methyl-2-buten-1-yl)- |