trimethyl propane-1,1,3-tricarboxylate structure
|
Common Name | trimethyl propane-1,1,3-tricarboxylate | ||
|---|---|---|---|---|
| CAS Number | 1733-16-0 | Molecular Weight | 218.20400 | |
| Density | 1.161g/cm3 | Boiling Point | 240.6ºC at 760mmHg | |
| Molecular Formula | C9H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 96.9ºC | |
| Name | trimethyl propane-1,1,3-tricarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.161g/cm3 |
|---|---|
| Boiling Point | 240.6ºC at 760mmHg |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20400 |
| Flash Point | 96.9ºC |
| Exact Mass | 218.07900 |
| PSA | 78.90000 |
| Vapour Pressure | 0.00749mmHg at 25°C |
| Index of Refraction | 1.434 |
| InChIKey | NTXSDWDNMMMUIO-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC(C(=O)OC)C(=O)OC |
| HS Code | 2917190090 |
|---|
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 217-066-3 |
| Propan-1.1.3-Tricarbonsaeuretrimethylester |
| Trimethyl-1.1.3-propantricarboxylat |
| 2-methoxycarbonylpentandioic acid dimethylester |
| 1,1,3-Propanetricarboxylic acid,trimethyl ester |