Isorhamnetin 7-O-alpha-L-rhamnoside structure
|
Common Name | Isorhamnetin 7-O-alpha-L-rhamnoside | ||
|---|---|---|---|---|
| CAS Number | 17331-72-5 | Molecular Weight | 462.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Isorhamnetin 7-O-alpha-L-rhamnosideIsorhamnetin 7-O-α-L-rhamnoside shows binding affinity with COVID-19 virus main protease[1]. |
| Name | quercetin 3'-O-methyl-7-O-α-L-rhamnopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | Isorhamnetin 7-O-α-L-rhamnoside shows binding affinity with COVID-19 virus main protease[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C22H22O11 |
|---|---|
| Molecular Weight | 462.40 |
| Exact Mass | 462.11600 |
| PSA | 179.28000 |
| LogP | 0.79170 |
| InChIKey | XLQFMBLUUSGXQY-FDTPGTFWSA-N |
| SMILES | COc1cc(-c2oc3cc(OC4OC(C)C(O)C(O)C4O)cc(O)c3c(=O)c2O)ccc1O |
| isorhamnetin 7-O-α-L-rhamnopyranoside |
| 3,5-Dihydroxy-2-(4-hydroxy-3-methoxy-phenyl)-7-((2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyl-tetrahydro-pyran-2-yloxy)-chromen-4-one |
| 7-O-α-L-rhamnoside of isorhamnetin |
| isorhamnetin 7-O-α-L-rhamnoside |